About N'-butyl-N-ethyloxamide
N'-butyl-N-ethyloxamide (PubChem CID 4532294) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is N'-butyl-N-ethyloxamide.
Molecular Properties
| Compound Name | N'-butyl-N-ethyloxamide |
| PubChem CID | 4532294 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | N'-butyl-N-ethyloxamide |
| SMILES | CCCCNC(=O)C(=O)NCC |
| InChI | InChI=1S/C8H16N2O2/c1-3-5-6-10-8(12)7(11)9-4-2/h3-6H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | NQNWEXYMLFXMLX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-butyl-N-ethyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butyl-N-ethyloxamide?
The IUPAC name of N'-butyl-N-ethyloxamide (CID 4532294) is N'-butyl-N-ethyloxamide.
What is the SMILES notation for N'-butyl-N-ethyloxamide?
The canonical SMILES for N'-butyl-N-ethyloxamide is CCCCNC(=O)C(=O)NCC.
What is the InChIKey of N'-butyl-N-ethyloxamide?
The InChIKey is NQNWEXYMLFXMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-3-5-6-10-8(12)7(11)9-4-2/h3-6H2,1-2H3,(H,9,11)(H,10,12).
What are the key properties of N'-butyl-N-ethyloxamide?
N'-butyl-N-ethyloxamide has a molecular weight of 172.23 g/mol, XLogP of 0.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butyl-N-ethyloxamide is sourced from PubChem (CID 4532294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).