About 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol
1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol (PubChem CID 4532861) has the molecular formula C32H32N2O
and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol.
Molecular Properties
| Compound Name | 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol |
| PubChem CID | 4532861 |
| Molecular Formula | C32H32N2O |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol |
| SMILES | Cc1ccc(NCC(O)Cn2c(-c3ccccc3)c(-c3ccccc3)c3cc(C)cc(C)c32)cc1 |
| InChI | InChI=1S/C32H32N2O/c1-22-14-16-27(17-15-22)33-20-28(35)21-34-31-24(3)18-23(2)19-29(31)30(25-10-6-4-7-11-25)32(34)26-12-8-5-9-13-26/h4-19,28,33,35H,20-21H2,1-3H3 |
| InChIKey | RMGFQOMAISSRHZ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol?
The IUPAC name of 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol (CID 4532861) is 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol.
What is the SMILES notation for 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol?
The canonical SMILES for 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol is Cc1ccc(NCC(O)Cn2c(-c3ccccc3)c(-c3ccccc3)c3cc(C)cc(C)c32)cc1.
What is the InChIKey of 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol?
The InChIKey is RMGFQOMAISSRHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H32N2O/c1-22-14-16-27(17-15-22)33-20-28(35)21-34-31-24(3)18-23(2)19-29(31)30(25-10-6-4-7-11-25)32(34)26-12-8-5-9-13-26/h4-19,28,33,35H,20-21H2,1-3H3.
What are the key properties of 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol?
1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol has a molecular weight of 460.62 g/mol, XLogP of 7.37, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,7-dimethyl-2,3-diphenylindol-1-yl)-3-(4-methylanilino)propan-2-ol is sourced from PubChem (CID 4532861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).