About benzene-1,2-dicarboximidamide
benzene-1,2-dicarboximidamide (PubChem CID 4532905) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is benzene-1,2-dicarboximidamide.
Molecular Properties
| Compound Name | benzene-1,2-dicarboximidamide |
| PubChem CID | 4532905 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | benzene-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1/C(N)=N/[H] |
| InChI | InChI=1S/C8H10N4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H3,9,10)(H3,11,12) |
| InChIKey | CZMCQHMXUGVADN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-dicarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-dicarboximidamide?
The IUPAC name of benzene-1,2-dicarboximidamide (CID 4532905) is benzene-1,2-dicarboximidamide.
What is the SMILES notation for benzene-1,2-dicarboximidamide?
The canonical SMILES for benzene-1,2-dicarboximidamide is [H]/N=C(\N)c1ccccc1/C(N)=N/[H].
What is the InChIKey of benzene-1,2-dicarboximidamide?
The InChIKey is CZMCQHMXUGVADN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H3,9,10)(H3,11,12).
What are the key properties of benzene-1,2-dicarboximidamide?
benzene-1,2-dicarboximidamide has a molecular weight of 162.20 g/mol, XLogP of 0.25, 2 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-dicarboximidamide is sourced from PubChem (CID 4532905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).