About 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol
4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol (PubChem CID 4533213) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol.
Molecular Properties
| Compound Name | 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol |
| PubChem CID | 4533213 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol |
| SMILES | OC1CC2CC1C1C2CC2OC21 |
| InChI | InChI=1S/C10H14O2/c11-7-2-4-1-6(7)9-5(4)3-8-10(9)12-8/h4-11H,1-3H2 |
| InChIKey | HZGOREPCCSVKGA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol?
The IUPAC name of 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol (CID 4533213) is 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol.
What is the SMILES notation for 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol?
The canonical SMILES for 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol is OC1CC2CC1C1C2CC2OC21.
What is the InChIKey of 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol?
The InChIKey is HZGOREPCCSVKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c11-7-2-4-1-6(7)9-5(4)3-8-10(9)12-8/h4-11H,1-3H2.
What are the key properties of 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol?
4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol has a molecular weight of 166.22 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-10-ol is sourced from PubChem (CID 4533213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).