C26H27N3O2S — CID 4533219
4-(3,4-dimethoxyphenyl)-2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-1,3-thiazole (PubChem CID 4533219) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-1,3-thiazole.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 4533219 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(N3CCn4c5c(c6cc(C)ccc64)CCCC53)n2)cc1OC |
| InChI | InChI=1S/C26H27N3O2S/c1-16-7-9-21-19(13-16)18-5-4-6-22-25(18)28(21)11-12-29(22)26-27-20(15-32-26)17-8-10-23(30-2)24(14-17)31-3/h7-10,13-15,22H,4-6,11-12H2,1-3H3 |
| InChIKey | QCAAVDMBZSQLLQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|