4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid

C15H11Cl2NO3 — CID 45337157

IUPAC4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid
SMILESO=C(O)c1ccc(C(=O)NCc2ccc(Cl)cc2Cl)cc1
InChIInChI=1S/C15H11Cl2NO3/c16-12-6-5-11(13(17)7-12)8-18-14(19)9-1-3-10(4-2-9)15(20)21/h1-7H,8H2,(H,18,19)(H,20,21)
InChIKeyCLYXNHHDQLMNEX-UHFFFAOYSA-N
MW324.16 g/mol
LogP3.62
Rot. Bonds4

About 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid

4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid (PubChem CID 45337157) has the molecular formula C15H11Cl2NO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid.

Molecular Properties

Compound Name4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid
PubChem CID45337157
Molecular FormulaC15H11Cl2NO3
Molecular Weight324.16 g/mol
Exact Mass323.01
IUPAC Name4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid
SMILESO=C(O)c1ccc(C(=O)NCc2ccc(Cl)cc2Cl)cc1
InChIInChI=1S/C15H11Cl2NO3/c16-12-6-5-11(13(17)7-12)8-18-14(19)9-1-3-10(4-2-9)15(20)21/h1-7H,8H2,(H,18,19)(H,20,21)
InChIKeyCLYXNHHDQLMNEX-UHFFFAOYSA-N
XLogP3.62
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.16
LogP ≤ 53.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid?
The IUPAC name of 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid (CID 45337157) is 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid.
What is the SMILES notation for 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid?
The canonical SMILES for 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid is O=C(O)c1ccc(C(=O)NCc2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid?
The InChIKey is CLYXNHHDQLMNEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2NO3/c16-12-6-5-11(13(17)7-12)8-18-14(19)9-1-3-10(4-2-9)15(20)21/h1-7H,8H2,(H,18,19)(H,20,21).
What are the key properties of 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid?
4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid has a molecular weight of 324.16 g/mol, XLogP of 3.62, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dichlorophenyl)methylcarbamoyl]benzoic acid is sourced from PubChem (CID 45337157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).