C17H17NO3S — CID 45341237
1-(4-phenylthiophene-2-carbonyl)piperidine-4-carboxylic acid (PubChem CID 45341237) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 1-(4-phenylthiophene-2-carbonyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(4-phenylthiophene-2-carbonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45341237 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-(4-phenylthiophene-2-carbonyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2cc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C17H17NO3S/c19-16(18-8-6-13(7-9-18)17(20)21)15-10-14(11-22-15)12-4-2-1-3-5-12/h1-5,10-11,13H,6-9H2,(H,20,21) |
| InChIKey | SRIPQEBCPMQNJH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |