C21H24N4O4S2 — CID 4534271
2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfanyl-3-(4-nitrophenyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-one (PubChem CID 4534271) has the molecular formula C21H24N4O4S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfanyl-3-(4-nitrophenyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfanyl-3-(4-nitrophenyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4534271 |
| Molecular Formula | C21H24N4O4S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfanyl-3-(4-nitrophenyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-one |
| SMILES | CCC1CCCCN1C(=O)CSc1nc2c(c(=O)n1-c1ccc([N+](=O)[O-])cc1)SCC2 |
| InChI | InChI=1S/C21H24N4O4S2/c1-2-14-5-3-4-11-23(14)18(26)13-31-21-22-17-10-12-30-19(17)20(27)24(21)15-6-8-16(9-7-15)25(28)29/h6-9,14H,2-5,10-13H2,1H3 |
| InChIKey | ULFDXLYZGCWSOI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|