C25H29N5OS — CID 4534328
N-[2-(cyclohexen-1-yl)ethyl]-2-[[4-(4-ethylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4534328) has the molecular formula C25H29N5OS and a molecular weight of 447.61 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[[4-(4-ethylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[[4-(4-ethylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4534328 |
| Molecular Formula | C25H29N5OS |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[[4-(4-ethylphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCc1ccc(-n2c(SCC(=O)NCCC3=CCCCC3)nnc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C25H29N5OS/c1-2-19-8-10-22(11-9-19)30-24(21-13-15-26-16-14-21)28-29-25(30)32-18-23(31)27-17-12-20-6-4-3-5-7-20/h6,8-11,13-16H,2-5,7,12,17-18H2,1H3,(H,27,31) |
| InChIKey | ALKWWYRWUAWMHA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|