About 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole
4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole (PubChem CID 4534736) has the molecular formula C18H22N4
and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole.
Molecular Properties
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole |
| PubChem CID | 4534736 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole |
| SMILES | Cc1ccc2c(c1)[nH]c1c(N3CC(C)CC(C)C3)ncnc12 |
| InChI | InChI=1S/C18H22N4/c1-11-4-5-14-15(7-11)21-17-16(14)19-10-20-18(17)22-8-12(2)6-13(3)9-22/h4-5,7,10,12-13,21H,6,8-9H2,1-3H3 |
| InChIKey | MJNFFGIXKKHGTG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole?
The IUPAC name of 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole (CID 4534736) is 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole.
What is the SMILES notation for 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole?
The canonical SMILES for 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole is Cc1ccc2c(c1)[nH]c1c(N3CC(C)CC(C)C3)ncnc12.
What is the InChIKey of 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole?
The InChIKey is MJNFFGIXKKHGTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4/c1-11-4-5-14-15(7-11)21-17-16(14)19-10-20-18(17)22-8-12(2)6-13(3)9-22/h4-5,7,10,12-13,21H,6,8-9H2,1-3H3.
What are the key properties of 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole?
4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole has a molecular weight of 294.40 g/mol, XLogP of 3.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylpiperidin-1-yl)-7-methyl-5H-pyrimido[5,4-b]indole is sourced from PubChem (CID 4534736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).