C27H43BrO — CID 4535173
3-bromo-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-2-one (PubChem CID 4535173) has the molecular formula C27H43BrO and a molecular weight of 463.54 g/mol. Its IUPAC name is 3-bromo-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-2-one.
| Compound Name | 3-bromo-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-2-one |
|---|---|
| PubChem CID | 4535173 |
| Molecular Formula | C27H43BrO |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 3-bromo-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-2-one |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(Br)C(=O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C27H43BrO/c1-17(2)7-6-8-18(3)21-11-12-22-20-10-9-19-15-24(28)25(29)16-27(19,5)23(20)13-14-26(21,22)4/h9,17-18,20-24H,6-8,10-16H2,1-5H3 |
| InChIKey | VIIVIWOTOXHLTG-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|