C24H28N2O4 — CID 45352671
(4-cyanophenyl)methyl 1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 45352671) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | (4-cyanophenyl)methyl 1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 45352671 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (4-cyanophenyl)methyl 1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | N#Cc1ccc(COC(=O)C2CC(O)CN2C(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H28N2O4/c25-12-15-1-3-16(4-2-15)14-30-22(28)21-8-20(27)13-26(21)23(29)24-9-17-5-18(10-24)7-19(6-17)11-24/h1-4,17-21,27H,5-11,13-14H2 |
| InChIKey | JLCYEXPPSAGBAV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |