About 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate
2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate (PubChem CID 45352797) has the molecular formula C12H13ClO3
and a molecular weight of 240.69 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate |
| PubChem CID | 45352797 |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate |
| SMILES | O=C(OC1CC2CCC1C2)c1ccc(Cl)o1 |
| InChI | InChI=1S/C12H13ClO3/c13-11-4-3-9(15-11)12(14)16-10-6-7-1-2-8(10)5-7/h3-4,7-8,10H,1-2,5-6H2 |
| InChIKey | GPSMNVRPVVQCEY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate?
The IUPAC name of 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate (CID 45352797) is 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate.
What is the SMILES notation for 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate?
The canonical SMILES for 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate is O=C(OC1CC2CCC1C2)c1ccc(Cl)o1.
What is the InChIKey of 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate?
The InChIKey is GPSMNVRPVVQCEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO3/c13-11-4-3-9(15-11)12(14)16-10-6-7-1-2-8(10)5-7/h3-4,7-8,10H,1-2,5-6H2.
What are the key properties of 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate?
2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate has a molecular weight of 240.69 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]heptanyl 5-chlorofuran-2-carboxylate is sourced from PubChem (CID 45352797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).