C13H15N5O2 — CID 45352874
(E)-3-[4-[(1-propan-2-yltetrazol-5-yl)amino]phenyl]prop-2-enoic acid (PubChem CID 45352874) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is (E)-3-[4-[(1-propan-2-yltetrazol-5-yl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(1-propan-2-yltetrazol-5-yl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 45352874 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (E)-3-[4-[(1-propan-2-yltetrazol-5-yl)amino]phenyl]prop-2-enoic acid |
| SMILES | CC(C)n1nnnc1Nc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C13H15N5O2/c1-9(2)18-13(15-16-17-18)14-11-6-3-10(4-7-11)5-8-12(19)20/h3-9H,1-2H3,(H,19,20)(H,14,15,17)/b8-5+ |
| InChIKey | FWTOVBSOCUPLMQ-VMPITWQZSA-N |
| XLogP | 2.10 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|