C24H32N4O2 — CID 45353115
2-[4-(2-hydroxyphenyl)piperazin-1-yl]-1-[4-(1-phenylethyl)piperazin-1-yl]ethanone (PubChem CID 45353115) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[4-(2-hydroxyphenyl)piperazin-1-yl]-1-[4-(1-phenylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(2-hydroxyphenyl)piperazin-1-yl]-1-[4-(1-phenylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 45353115 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-[4-(2-hydroxyphenyl)piperazin-1-yl]-1-[4-(1-phenylethyl)piperazin-1-yl]ethanone |
| SMILES | CC(c1ccccc1)N1CCN(C(=O)CN2CCN(c3ccccc3O)CC2)CC1 |
| InChI | InChI=1S/C24H32N4O2/c1-20(21-7-3-2-4-8-21)26-15-17-28(18-16-26)24(30)19-25-11-13-27(14-12-25)22-9-5-6-10-23(22)29/h2-10,20,29H,11-19H2,1H3 |
| InChIKey | UIDCMQDULHCGJM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |