C23H24ClN3O3S — CID 45353380
N-[(4-chlorophenyl)-cyclopropylmethyl]-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 45353380) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-cyclopropylmethyl]-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)-cyclopropylmethyl]-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 45353380 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-[(4-chlorophenyl)-cyclopropylmethyl]-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCC(C(=O)NC(c3ccc(Cl)cc3)C3CC3)CC2)cc1 |
| InChI | InChI=1S/C23H24ClN3O3S/c24-20-7-5-18(6-8-20)22(17-3-4-17)26-23(28)19-11-13-27(14-12-19)31(29,30)21-9-1-16(15-25)2-10-21/h1-2,5-10,17,19,22H,3-4,11-14H2,(H,26,28) |
| InChIKey | HZWXWADGQRHUGN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |