C24H23N3O4S — CID 45354300
1-cyclopentyl-3-[2-oxo-2-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]imidazolidine-2,4,5-trione (PubChem CID 45354300) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-oxo-2-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-cyclopentyl-3-[2-oxo-2-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 45354300 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-cyclopentyl-3-[2-oxo-2-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(C2CCCC2)C(=O)N1CC(=O)N1c2ccccc2SCC1c1ccccc1 |
| InChI | InChI=1S/C24H23N3O4S/c28-21(14-25-22(29)23(30)26(24(25)31)17-10-4-5-11-17)27-18-12-6-7-13-20(18)32-15-19(27)16-8-2-1-3-9-16/h1-3,6-9,12-13,17,19H,4-5,10-11,14-15H2 |
| InChIKey | QIDSLLBLIABCAW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|