C25H27N3O5S — CID 45355105
2-(2-acetyl-1H-isoquinolin-1-yl)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 45355105) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is 2-(2-acetyl-1H-isoquinolin-1-yl)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 45355105 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)CC3c4ccccc4C=CN3C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C25H27N3O5S/c1-18(29)20-7-9-22(10-8-20)34(32,33)27-15-13-26(14-16-27)25(31)17-24-23-6-4-3-5-21(23)11-12-28(24)19(2)30/h3-12,24H,13-17H2,1-2H3 |
| InChIKey | BWLYJFJSLHITHV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |