About [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea
[(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea (PubChem CID 4535555) has the molecular formula C13H15N3OS
and a molecular weight of 261.35 g/mol. Its IUPAC name is [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea.
Molecular Properties
| Compound Name | [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea |
| PubChem CID | 4535555 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea |
| SMILES | Cc1cc2oc(C=NNC(N)=S)c(C)c2cc1C |
| InChI | InChI=1S/C13H15N3OS/c1-7-4-10-9(3)12(6-15-16-13(14)18)17-11(10)5-8(7)2/h4-6H,1-3H3,(H3,14,16,18) |
| InChIKey | SVUUZTXDQIZPKL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea?
The IUPAC name of [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea (CID 4535555) is [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea.
What is the SMILES notation for [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea?
The canonical SMILES for [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea is Cc1cc2oc(C=NNC(N)=S)c(C)c2cc1C.
What is the InChIKey of [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea?
The InChIKey is SVUUZTXDQIZPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3OS/c1-7-4-10-9(3)12(6-15-16-13(14)18)17-11(10)5-8(7)2/h4-6H,1-3H3,(H3,14,16,18).
What are the key properties of [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea?
[(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea has a molecular weight of 261.35 g/mol, XLogP of 2.53, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,5,6-trimethyl-1-benzofuran-2-yl)methylideneamino]thiourea is sourced from PubChem (CID 4535555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).