C26H21ClN2O — CID 45356251
(2S)-5-chloro-1,3,3-trimethylspiro[indole-2,2'-phenanthro[9,10-b][1,4]oxazine] (PubChem CID 45356251) has the molecular formula C26H21ClN2O and a molecular weight of 412.92 g/mol. Its IUPAC name is (2S)-5-chloro-1,3,3-trimethylspiro[indole-2,2'-phenanthro[9,10-b][1,4]oxazine].
| Compound Name | (2S)-5-chloro-1,3,3-trimethylspiro[indole-2,2'-phenanthro[9,10-b][1,4]oxazine] |
|---|---|
| PubChem CID | 45356251 |
| Molecular Formula | C26H21ClN2O |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (2S)-5-chloro-1,3,3-trimethylspiro[indole-2,2'-phenanthro[9,10-b][1,4]oxazine] |
| SMILES | CN1c2ccc(Cl)cc2C(C)(C)[C@]12C=Nc1c(c3ccccc3c3ccccc13)O2 |
| InChI | InChI=1S/C26H21ClN2O/c1-25(2)21-14-16(27)12-13-22(21)29(3)26(25)15-28-23-19-10-6-4-8-17(19)18-9-5-7-11-20(18)24(23)30-26/h4-15H,1-3H3/t26-/m1/s1 |
| InChIKey | WQXPQBJFCUXKJV-AREMUKBSSA-N |
| XLogP | 6.86 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|