C15H15N3O7 — CID 45356891
(4-nitroanilino) (5R,6S)-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 45356891) has the molecular formula C15H15N3O7 and a molecular weight of 349.30 g/mol. Its IUPAC name is (4-nitroanilino) (5R,6S)-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitroanilino) (5R,6S)-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 45356891 |
| Molecular Formula | C15H15N3O7 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (4-nitroanilino) (5R,6S)-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)ONc3ccc([N+](=O)[O-])cc3)C(=O)C[C@H]12 |
| InChI | InChI=1S/C15H15N3O7/c1-7(19)12-10-6-11(20)13(17(10)14(12)21)15(22)25-16-8-2-4-9(5-3-8)18(23)24/h2-5,7,10,12-13,16,19H,6H2,1H3/t7-,10-,12-,13?/m1/s1 |
| InChIKey | CLJLZTWNLLMCFE-DPPNOMGMSA-N |
| XLogP | 0.01 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|