About bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride
bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride (PubChem CID 45357010) has the molecular formula C17H16ClF4NO
and a molecular weight of 361.77 g/mol. Its IUPAC name is bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride |
| PubChem CID | 45357010 |
| Molecular Formula | C17H16ClF4NO |
| Molecular Weight | 361.77 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride |
| SMILES | Cl.OC(c1ccc(F)c(F)c1)(c1ccc(F)c(F)c1)[C@H]1CCCN1 |
| InChI | InChI=1S/C17H15F4NO.ClH/c18-12-5-3-10(8-14(12)20)17(23,16-2-1-7-22-16)11-4-6-13(19)15(21)9-11;/h3-6,8-9,16,22-23H,1-2,7H2;1H/t16-;/m1./s1 |
| InChIKey | KZESFOYIPJWRQZ-PKLMIRHRSA-N |
| XLogP | 3.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.77 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride?
The IUPAC name of bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride (CID 45357010) is bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride.
What is the SMILES notation for bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride?
The canonical SMILES for bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride is Cl.OC(c1ccc(F)c(F)c1)(c1ccc(F)c(F)c1)[C@H]1CCCN1.
What is the InChIKey of bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride?
The InChIKey is KZESFOYIPJWRQZ-PKLMIRHRSA-N. The full InChI is InChI=1S/C17H15F4NO.ClH/c18-12-5-3-10(8-14(12)20)17(23,16-2-1-7-22-16)11-4-6-13(19)15(21)9-11;/h3-6,8-9,16,22-23H,1-2,7H2;1H/t16-;/m1./s1.
What are the key properties of bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride?
bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride has a molecular weight of 361.77 g/mol, XLogP of 3.65, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,4-difluorophenyl)-[(2R)-pyrrolidin-2-yl]methanol;hydrochloride is sourced from PubChem (CID 45357010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).