About 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride
3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride (PubChem CID 45357286) has the molecular formula C9H14Cl2N4
and a molecular weight of 249.14 g/mol. Its IUPAC name is 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride |
| PubChem CID | 45357286 |
| Molecular Formula | C9H14Cl2N4 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.NCCCc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C9H12N4.2ClH/c10-5-1-4-8-12-7-3-2-6-11-9(7)13-8;;/h2-3,6H,1,4-5,10H2,(H,11,12,13);2*1H |
| InChIKey | GNPXLSZZEWMJGC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride?
The IUPAC name of 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride (CID 45357286) is 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride.
What is the SMILES notation for 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride?
The canonical SMILES for 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride is Cl.Cl.NCCCc1nc2ncccc2[nH]1.
What is the InChIKey of 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride?
The InChIKey is GNPXLSZZEWMJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4.2ClH/c10-5-1-4-8-12-7-3-2-6-11-9(7)13-8;;/h2-3,6H,1,4-5,10H2,(H,11,12,13);2*1H.
What are the key properties of 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride?
3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride has a molecular weight of 249.14 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine;dihydrochloride is sourced from PubChem (CID 45357286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).