C21H36F3NO5 — CID 45357437
3-[9-(2,2,2-trifluoroacetyl)oxyhexadecanoylamino]propanoic acid (PubChem CID 45357437) has the molecular formula C21H36F3NO5 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-[9-(2,2,2-trifluoroacetyl)oxyhexadecanoylamino]propanoic acid.
| Compound Name | 3-[9-(2,2,2-trifluoroacetyl)oxyhexadecanoylamino]propanoic acid |
|---|---|
| PubChem CID | 45357437 |
| Molecular Formula | C21H36F3NO5 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 3-[9-(2,2,2-trifluoroacetyl)oxyhexadecanoylamino]propanoic acid |
| SMILES | CCCCCCCC(CCCCCCCC(=O)NCCC(=O)O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H36F3NO5/c1-2-3-4-6-9-12-17(30-20(29)21(22,23)24)13-10-7-5-8-11-14-18(26)25-16-15-19(27)28/h17H,2-16H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | XBSMDRJOBWFCRZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|