C8H16ClN — CID 45357936
(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole;hydrochloride (PubChem CID 45357936) has the molecular formula C8H16ClN and a molecular weight of 161.68 g/mol. Its IUPAC name is (3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole;hydrochloride.
| Compound Name | (3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole;hydrochloride |
|---|---|
| PubChem CID | 45357936 |
| Molecular Formula | C8H16ClN |
| Molecular Weight | 161.68 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole;hydrochloride |
| SMILES | C1CC[C@H]2CNC[C@H]2C1.Cl |
| InChI | InChI=1S/C8H15N.ClH/c1-2-4-8-6-9-5-7(8)3-1;/h7-9H,1-6H2;1H/t7-,8+; |
| InChIKey | CLQIZUYXKFTUEB-KVZVIFLMSA-N |
| XLogP | 1.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.68 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |