About 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol
2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol (PubChem CID 45357962) has the molecular formula C7H10OS
and a molecular weight of 142.22 g/mol. Its IUPAC name is 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol |
| PubChem CID | 45357962 |
| Molecular Formula | C7H10OS |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol |
| SMILES | OCCC1=CC=CC1S |
| InChI | InChI=1S/C7H10OS/c8-5-4-6-2-1-3-7(6)9/h1-3,7-9H,4-5H2 |
| InChIKey | MFCIMOFDGZHQAD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol?
The IUPAC name of 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol (CID 45357962) is 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol.
What is the SMILES notation for 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol?
The canonical SMILES for 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol is OCCC1=CC=CC1S.
What is the InChIKey of 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol?
The InChIKey is MFCIMOFDGZHQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10OS/c8-5-4-6-2-1-3-7(6)9/h1-3,7-9H,4-5H2.
What are the key properties of 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol?
2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol has a molecular weight of 142.22 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-sulfanylcyclopenta-1,3-dien-1-yl)ethanol is sourced from PubChem (CID 45357962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).