C16H18N4O7S — CID 45358172
3-(carbamoyloxymethyl)-8-[[(2E)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 45358172) has the molecular formula C16H18N4O7S and a molecular weight of 410.41 g/mol. Its IUPAC name is 3-(carbamoyloxymethyl)-8-[[(2E)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 3-(carbamoyloxymethyl)-8-[[(2E)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 45358172 |
| Molecular Formula | C16H18N4O7S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 3-(carbamoyloxymethyl)-8-[[(2E)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(/C(=O)NC1CC2SCC(COC(N)=O)=C(C(=O)O)N12)c1ccco1 |
| InChI | InChI=1S/C16H18N4O7S/c1-25-19-12(9-3-2-4-26-9)14(21)18-10-5-11-20(10)13(15(22)23)8(7-28-11)6-27-16(17)24/h2-4,10-11H,5-7H2,1H3,(H2,17,24)(H,18,21)(H,22,23)/b19-12+ |
| InChIKey | UNJOWIMAAOLGSU-XDHOZWIPSA-N |
| XLogP | 0.28 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|