About 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran
6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran (PubChem CID 45358217) has the molecular formula C14H14O
and a molecular weight of 198.27 g/mol. Its IUPAC name is 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran.
Molecular Properties
| Compound Name | 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran |
| PubChem CID | 45358217 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran |
| SMILES | C1=CC(c2ccccc2)C=C2COCC12 |
| InChI | InChI=1S/C14H14O/c1-2-4-11(5-3-1)12-6-7-13-9-15-10-14(13)8-12/h1-8,12-13H,9-10H2 |
| InChIKey | GVPCGIWSCNTQAB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran?
The IUPAC name of 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran (CID 45358217) is 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran.
What is the SMILES notation for 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran?
The canonical SMILES for 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran is C1=CC(c2ccccc2)C=C2COCC12.
What is the InChIKey of 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran?
The InChIKey is GVPCGIWSCNTQAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O/c1-2-4-11(5-3-1)12-6-7-13-9-15-10-14(13)8-12/h1-8,12-13H,9-10H2.
What are the key properties of 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran?
6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran has a molecular weight of 198.27 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran is sourced from PubChem (CID 45358217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).