C15H16O — CID 45358218
5-methyl-6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran (PubChem CID 45358218) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is 5-methyl-6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran.
| Compound Name | 5-methyl-6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 45358218 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 5-methyl-6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran |
| SMILES | CC1=CC2COCC2=CC1c1ccccc1 |
| InChI | InChI=1S/C15H16O/c1-11-7-13-9-16-10-14(13)8-15(11)12-5-3-2-4-6-12/h2-8,13,15H,9-10H2,1H3 |
| InChIKey | IXFMZIUGSMQJCC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|