C8H16F3NO — CID 45358257
5-amino-6,6,6-trifluoro-2,2-dimethylhexan-3-ol (PubChem CID 45358257) has the molecular formula C8H16F3NO and a molecular weight of 199.22 g/mol. Its IUPAC name is 5-amino-6,6,6-trifluoro-2,2-dimethylhexan-3-ol.
| Compound Name | 5-amino-6,6,6-trifluoro-2,2-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 45358257 |
| Molecular Formula | C8H16F3NO |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 5-amino-6,6,6-trifluoro-2,2-dimethylhexan-3-ol |
| SMILES | CC(C)(C)C(O)CC(N)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NO/c1-7(2,3)6(13)4-5(12)8(9,10)11/h5-6,13H,4,12H2,1-3H3 |
| InChIKey | MQEBHOWPDVXEIV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |