About 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid
2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid (PubChem CID 45359443) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid |
| PubChem CID | 45359443 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid |
| SMILES | CC(=O)NC1C=CC(CCC(NC(C)=O)C(=O)O)C=C1 |
| InChI | InChI=1S/C14H20N2O4/c1-9(17)15-12-6-3-11(4-7-12)5-8-13(14(19)20)16-10(2)18/h3-4,6-7,11-13H,5,8H2,1-2H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | URLVLCWCLQXIAQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid?
The IUPAC name of 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid (CID 45359443) is 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid.
What is the SMILES notation for 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid?
The canonical SMILES for 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid is CC(=O)NC1C=CC(CCC(NC(C)=O)C(=O)O)C=C1.
What is the InChIKey of 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid?
The InChIKey is URLVLCWCLQXIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-9(17)15-12-6-3-11(4-7-12)5-8-13(14(19)20)16-10(2)18/h3-4,6-7,11-13H,5,8H2,1-2H3,(H,15,17)(H,16,18)(H,19,20).
What are the key properties of 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid?
2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid has a molecular weight of 280.32 g/mol, XLogP of 0.60, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-4-(4-acetamidocyclohexa-2,5-dien-1-yl)butanoic acid is sourced from PubChem (CID 45359443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).