C31H46N4O7 — CID 45359468
6-benzyl-3-butan-2-yl-9-(7,8-dihydroxy-6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 45359468) has the molecular formula C31H46N4O7 and a molecular weight of 586.73 g/mol. Its IUPAC name is 6-benzyl-3-butan-2-yl-9-(7,8-dihydroxy-6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | 6-benzyl-3-butan-2-yl-9-(7,8-dihydroxy-6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 45359468 |
| Molecular Formula | C31H46N4O7 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | 6-benzyl-3-butan-2-yl-9-(7,8-dihydroxy-6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CCC(C)C1NC(=O)C(Cc2ccccc2)NC(=O)C(CCCCCC(=O)C(O)CO)NC(=O)C2CCCCN2C1=O |
| InChI | InChI=1S/C31H46N4O7/c1-3-20(2)27-31(42)35-17-11-10-15-24(35)30(41)32-22(14-8-5-9-16-25(37)26(38)19-36)28(39)33-23(29(40)34-27)18-21-12-6-4-7-13-21/h4,6-7,12-13,20,22-24,26-27,36,38H,3,5,8-11,14-19H2,1-2H3,(H,32,41)(H,33,39)(H,34,40) |
| InChIKey | YSNRSVKJRYQIIA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|