C33H40O10 — CID 45359622
[(6E,11E)-3a,9,13-triacetyloxy-2,5,8,8,12-pentamethyl-4,10-dioxo-2,3,5,9,13,13a-hexahydro-1H-cyclopenta[12]annulen-1-yl] benzoate (PubChem CID 45359622) has the molecular formula C33H40O10 and a molecular weight of 596.67 g/mol. Its IUPAC name is [(6E,11E)-3a,9,13-triacetyloxy-2,5,8,8,12-pentamethyl-4,10-dioxo-2,3,5,9,13,13a-hexahydro-1H-cyclopenta[12]annulen-1-yl] benzoate.
| Compound Name | [(6E,11E)-3a,9,13-triacetyloxy-2,5,8,8,12-pentamethyl-4,10-dioxo-2,3,5,9,13,13a-hexahydro-1H-cyclopenta[12]annulen-1-yl] benzoate |
|---|---|
| PubChem CID | 45359622 |
| Molecular Formula | C33H40O10 |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | [(6E,11E)-3a,9,13-triacetyloxy-2,5,8,8,12-pentamethyl-4,10-dioxo-2,3,5,9,13,13a-hexahydro-1H-cyclopenta[12]annulen-1-yl] benzoate |
| SMILES | CC(=O)OC1/C(C)=C/C(=O)C(OC(C)=O)C(C)(C)/C=C/C(C)C(=O)C2(OC(C)=O)CC(C)C(OC(=O)c3ccccc3)C12 |
| InChI | InChI=1S/C33H40O10/c1-18-14-15-32(7,8)30(41-22(5)35)25(37)16-19(2)27(40-21(4)34)26-28(42-31(39)24-12-10-9-11-13-24)20(3)17-33(26,29(18)38)43-23(6)36/h9-16,18,20,26-28,30H,17H2,1-8H3/b15-14+,19-16+ |
| InChIKey | MVZQKKYLZHTDHU-VNXILKCPSA-N |
| XLogP | 4.35 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|