C30H42O10 — CID 45359624
[(1R,2R,3R,4S,5S,7R,9S,10R,13R,14R)-2,7,13-triacetyloxy-1,5,9,12,12-pentamethyl-8,15-dioxo-4-tetracyclo[7.6.0.03,7.010,14]pentadecanyl] butanoate (PubChem CID 45359624) has the molecular formula C30H42O10 and a molecular weight of 562.66 g/mol. Its IUPAC name is [(1R,2R,3R,4S,5S,7R,9S,10R,13R,14R)-2,7,13-triacetyloxy-1,5,9,12,12-pentamethyl-8,15-dioxo-4-tetracyclo[7.6.0.03,7.010,14]pentadecanyl] butanoate.
| Compound Name | [(1R,2R,3R,4S,5S,7R,9S,10R,13R,14R)-2,7,13-triacetyloxy-1,5,9,12,12-pentamethyl-8,15-dioxo-4-tetracyclo[7.6.0.03,7.010,14]pentadecanyl] butanoate |
|---|---|
| PubChem CID | 45359624 |
| Molecular Formula | C30H42O10 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | [(1R,2R,3R,4S,5S,7R,9S,10R,13R,14R)-2,7,13-triacetyloxy-1,5,9,12,12-pentamethyl-8,15-dioxo-4-tetracyclo[7.6.0.03,7.010,14]pentadecanyl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1[C@@H]2[C@@H](OC(C)=O)[C@]3(C)C(=O)[C@H]4[C@@H](OC(C)=O)C(C)(C)C[C@H]4[C@]3(C)C(=O)[C@@]2(OC(C)=O)C[C@@H]1C |
| InChI | InChI=1S/C30H42O10/c1-10-11-19(34)39-22-14(2)12-30(40-17(5)33)21(22)25(38-16(4)32)29(9)23(35)20-18(28(29,8)26(30)36)13-27(6,7)24(20)37-15(3)31/h14,18,20-22,24-25H,10-13H2,1-9H3/t14-,18+,20-,21+,22-,24+,25+,28+,29-,30+/m0/s1 |
| InChIKey | JQCBBCVOQHOGTI-HROOPKDASA-N |
| XLogP | 3.36 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|