C19H26O6 — CID 45360229
[(3R,3aS,5S,6E,9S,10E,11aS)-5-acetyloxy-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] acetate (PubChem CID 45360229) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(3R,3aS,5S,6E,9S,10E,11aS)-5-acetyloxy-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] acetate.
| Compound Name | [(3R,3aS,5S,6E,9S,10E,11aS)-5-acetyloxy-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] acetate |
|---|---|
| PubChem CID | 45360229 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(3R,3aS,5S,6E,9S,10E,11aS)-5-acetyloxy-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1C/C=C(\C)[C@@H](OC(C)=O)C[C@@H]2[C@@H](/C=C/1C)OC(=O)[C@@H]2C |
| InChI | InChI=1S/C19H26O6/c1-10-6-7-16(23-13(4)20)11(2)8-18-15(12(3)19(22)25-18)9-17(10)24-14(5)21/h6,8,12,15-18H,7,9H2,1-5H3/b10-6+,11-8+/t12-,15+,16+,17+,18-/m1/s1 |
| InChIKey | GOGQNNWYPKCAMI-TXJQVROXSA-N |
| XLogP | 2.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|