About 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea
1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea (PubChem CID 4536044) has the molecular formula C15H16N5O+
and a molecular weight of 282.33 g/mol. Its IUPAC name is 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea.
Molecular Properties
| Compound Name | 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea |
| PubChem CID | 4536044 |
| Molecular Formula | C15H16N5O+ |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea |
| SMILES | Cc1cc(C)c(C#N)c(NNC(=O)Nc2ccccc2)[nH+]1 |
| InChI | InChI=1S/C15H15N5O/c1-10-8-11(2)17-14(13(10)9-16)19-20-15(21)18-12-6-4-3-5-7-12/h3-8H,1-2H3,(H,17,19)(H2,18,20,21)/p+1 |
| InChIKey | WLDMLCMXUYEEEL-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea?
The IUPAC name of 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea (CID 4536044) is 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea.
What is the SMILES notation for 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea?
The canonical SMILES for 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea is Cc1cc(C)c(C#N)c(NNC(=O)Nc2ccccc2)[nH+]1.
What is the InChIKey of 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea?
The InChIKey is WLDMLCMXUYEEEL-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H15N5O/c1-10-8-11(2)17-14(13(10)9-16)19-20-15(21)18-12-6-4-3-5-7-12/h3-8H,1-2H3,(H,17,19)(H2,18,20,21)/p+1.
What are the key properties of 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea?
1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea has a molecular weight of 282.33 g/mol, XLogP of 2.14, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-cyano-4,6-dimethylpyridin-1-ium-2-yl)amino]-3-phenylurea is sourced from PubChem (CID 4536044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).