C20H29N3O7 — CID 45360610
methyl 4-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexanecarbonyl]amino]butanoate (PubChem CID 45360610) has the molecular formula C20H29N3O7 and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl 4-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexanecarbonyl]amino]butanoate.
| Compound Name | methyl 4-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexanecarbonyl]amino]butanoate |
|---|---|
| PubChem CID | 45360610 |
| Molecular Formula | C20H29N3O7 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | methyl 4-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexanecarbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H29N3O7/c1-12-5-7-13(8-6-12)22-19(28)23-14-10-20(29,11-15(24)17(14)26)18(27)21-9-3-4-16(25)30-2/h5-8,14-15,17,24,26,29H,3-4,9-11H2,1-2H3,(H,21,27)(H2,22,23,28)/t14-,15+,17+,20-/m0/s1 |
| InChIKey | WHEGHTBBWAWUDN-VZHLBOQGSA-N |
| XLogP | -0.20 |
| TPSA | 157.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|