C20H30N4O2 — CID 45360623
3-[(4R,7S,8aS)-7-(benzylamino)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide (PubChem CID 45360623) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-7-(benzylamino)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide.
| Compound Name | 3-[(4R,7S,8aS)-7-(benzylamino)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 45360623 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 3-[(4R,7S,8aS)-7-(benzylamino)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CC[C@@H]1CNC(=O)[C@@H]2C[C@H](NCc3ccccc3)CN12 |
| InChI | InChI=1S/C20H30N4O2/c1-14(2)23-19(25)9-8-17-12-22-20(26)18-10-16(13-24(17)18)21-11-15-6-4-3-5-7-15/h3-7,14,16-18,21H,8-13H2,1-2H3,(H,22,26)(H,23,25)/t16-,17+,18-/m0/s1 |
| InChIKey | UGTVUNZFOUACSU-KSZLIROESA-N |
| XLogP | 1.02 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |