C28H35N5O3 — CID 45360665
3-[(4R,7S,8aS)-7-[(1-methylindol-3-yl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 45360665) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-7-[(1-methylindol-3-yl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-[(4R,7S,8aS)-7-[(1-methylindol-3-yl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 45360665 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 3-[(4R,7S,8aS)-7-[(1-methylindol-3-yl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)CC[C@@H]2CNC(=O)[C@@H]3C[C@H](NCc4cn(C)c5ccccc45)CN23)cc1 |
| InChI | InChI=1S/C28H35N5O3/c1-32-17-20(24-5-3-4-6-25(24)32)15-29-21-13-26-28(35)31-16-22(33(26)18-21)9-12-27(34)30-14-19-7-10-23(36-2)11-8-19/h3-8,10-11,17,21-22,26,29H,9,12-16,18H2,1-2H3,(H,30,34)(H,31,35)/t21-,22+,26-/m0/s1 |
| InChIKey | JCIBCCBRKHCWGQ-VRUMLPLGSA-N |
| XLogP | 2.31 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |