C14H26N4O2 — CID 45360751
3-[(4R,7S,8aS)-7-amino-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide (PubChem CID 45360751) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-7-amino-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide.
| Compound Name | 3-[(4R,7S,8aS)-7-amino-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 45360751 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 3-[(4R,7S,8aS)-7-amino-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CC[C@@H]1CNC(=O)[C@@H]2C[C@H](N)CN12 |
| InChI | InChI=1S/C14H26N4O2/c1-3-17(4-2)13(19)6-5-11-8-16-14(20)12-7-10(15)9-18(11)12/h10-12H,3-9,15H2,1-2H3,(H,16,20)/t10-,11+,12-/m0/s1 |
| InChIKey | HXYOJTOKNGJLBL-TUAOUCFPSA-N |
| XLogP | -0.47 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |