C21H31FN4O2 — CID 45360757
3-[(4R,7S,8aS)-7-[(4-fluorophenyl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide (PubChem CID 45360757) has the molecular formula C21H31FN4O2 and a molecular weight of 390.50 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-7-[(4-fluorophenyl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide.
| Compound Name | 3-[(4R,7S,8aS)-7-[(4-fluorophenyl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 45360757 |
| Molecular Formula | C21H31FN4O2 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 3-[(4R,7S,8aS)-7-[(4-fluorophenyl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CC[C@@H]1CNC(=O)[C@@H]2C[C@H](NCc3ccc(F)cc3)CN12 |
| InChI | InChI=1S/C21H31FN4O2/c1-3-25(4-2)20(27)10-9-18-13-24-21(28)19-11-17(14-26(18)19)23-12-15-5-7-16(22)8-6-15/h5-8,17-19,23H,3-4,9-14H2,1-2H3,(H,24,28)/t17-,18+,19-/m0/s1 |
| InChIKey | VWXCDQOMNYUFQG-OTWHNJEPSA-N |
| XLogP | 1.51 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |