C5H4N3O4- — CID 4536079
2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetate (PubChem CID 4536079) has the molecular formula C5H4N3O4- and a molecular weight of 170.10 g/mol. Its IUPAC name is 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetate.
| Compound Name | 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetate |
|---|---|
| PubChem CID | 4536079 |
| Molecular Formula | C5H4N3O4- |
| Molecular Weight | 170.10 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetate |
| SMILES | O=C([O-])Cc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H5N3O4/c9-3(10)1-2-4(11)6-5(12)8-7-2/h1H2,(H,9,10)(H2,6,8,11,12)/p-1 |
| InChIKey | GZJVDADUPNZONF-UHFFFAOYSA-M |
| XLogP | -3.25 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.10 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |