C24H30N4O2S — CID 45360882
(2S,5aS,8aR)-2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-1-methyl-6-(thiophen-2-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one (PubChem CID 45360882) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is (2S,5aS,8aR)-2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-1-methyl-6-(thiophen-2-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | (2S,5aS,8aR)-2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-1-methyl-6-(thiophen-2-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 45360882 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (2S,5aS,8aR)-2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-1-methyl-6-(thiophen-2-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
| SMILES | CN1[C@@H](CCC(=O)N2CCc3ccccc32)CNC(=O)[C@@H]2[C@H]1CCN2Cc1cccs1 |
| InChI | InChI=1S/C24H30N4O2S/c1-26-18(8-9-22(29)28-13-10-17-5-2-3-7-20(17)28)15-25-24(30)23-21(26)11-12-27(23)16-19-6-4-14-31-19/h2-7,14,18,21,23H,8-13,15-16H2,1H3,(H,25,30)/t18-,21+,23-/m0/s1 |
| InChIKey | IXDUJADCVQNKGA-ZEYPLWLESA-N |
| XLogP | 2.49 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |