C21H37N5O3 — CID 45361074
(2S,5aS,8aR)-1-methyl-6-(1-methylpiperidin-4-yl)-2-(3-morpholin-4-yl-3-oxopropyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one (PubChem CID 45361074) has the molecular formula C21H37N5O3 and a molecular weight of 407.56 g/mol. Its IUPAC name is (2S,5aS,8aR)-1-methyl-6-(1-methylpiperidin-4-yl)-2-(3-morpholin-4-yl-3-oxopropyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | (2S,5aS,8aR)-1-methyl-6-(1-methylpiperidin-4-yl)-2-(3-morpholin-4-yl-3-oxopropyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 45361074 |
| Molecular Formula | C21H37N5O3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | (2S,5aS,8aR)-1-methyl-6-(1-methylpiperidin-4-yl)-2-(3-morpholin-4-yl-3-oxopropyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
| SMILES | CN1CCC(N2CC[C@@H]3[C@H]2C(=O)NC[C@H](CCC(=O)N2CCOCC2)N3C)CC1 |
| InChI | InChI=1S/C21H37N5O3/c1-23-8-5-16(6-9-23)26-10-7-18-20(26)21(28)22-15-17(24(18)2)3-4-19(27)25-11-13-29-14-12-25/h16-18,20H,3-15H2,1-2H3,(H,22,28)/t17-,18+,20-/m0/s1 |
| InChIKey | SATKHVNCMMZPHT-NSHGMRRFSA-N |
| XLogP | -0.41 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |