C26H34N2O3S — CID 45361312
(2S)-2-[(4S,4aS,5S,8aS)-5-hydroxy-4,8a-dimethyl-2-phenyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one (PubChem CID 45361312) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is (2S)-2-[(4S,4aS,5S,8aS)-5-hydroxy-4,8a-dimethyl-2-phenyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one.
| Compound Name | (2S)-2-[(4S,4aS,5S,8aS)-5-hydroxy-4,8a-dimethyl-2-phenyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 45361312 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (2S)-2-[(4S,4aS,5S,8aS)-5-hydroxy-4,8a-dimethyl-2-phenyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one |
| SMILES | C[C@H](C(=O)N1CCOCC1)C1CC[C@@]2(C)Cc3sc(-c4ccccc4)nc3[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C26H34N2O3S/c1-16(25(30)28-11-13-31-14-12-28)19-9-10-26(3)15-20-22(17(2)21(26)23(19)29)27-24(32-20)18-7-5-4-6-8-18/h4-8,16-17,19,21,23,29H,9-15H2,1-3H3/t16-,17-,19?,21+,23-,26-/m0/s1 |
| InChIKey | JFQXJNUIKLCOKV-XFCAYYMSSA-N |
| XLogP | 4.36 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |