C24H35FN2O3 — CID 45361356
(2S)-2-[(1S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[(4-fluorophenyl)methyl]propanamide (PubChem CID 45361356) has the molecular formula C24H35FN2O3 and a molecular weight of 418.55 g/mol. Its IUPAC name is (2S)-2-[(1S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[(4-fluorophenyl)methyl]propanamide.
| Compound Name | (2S)-2-[(1S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[(4-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 45361356 |
| Molecular Formula | C24H35FN2O3 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (2S)-2-[(1S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[(4-fluorophenyl)methyl]propanamide |
| SMILES | CC(=O)N[C@H]1CC[C@]2(C)CCC([C@H](C)C(=O)NCc3ccc(F)cc3)[C@H](O)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C24H35FN2O3/c1-14(23(30)26-13-17-5-7-18(25)8-6-17)19-9-11-24(4)12-10-20(27-16(3)28)15(2)21(24)22(19)29/h5-8,14-15,19-22,29H,9-13H2,1-4H3,(H,26,30)(H,27,28)/t14-,15+,19?,20-,21+,22-,24-/m0/s1 |
| InChIKey | HHVXTHDWGRNAJO-FZYOFFSQSA-N |
| XLogP | 3.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |