C10H8FN3OS3 — CID 4536382
2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 4536382) has the molecular formula C10H8FN3OS3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | 2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4536382 |
| Molecular Formula | C10H8FN3OS3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | NC(=O)CSc1nn(-c2ccc(F)cc2)c(=S)s1 |
| InChI | InChI=1S/C10H8FN3OS3/c11-6-1-3-7(4-2-6)14-10(16)18-9(13-14)17-5-8(12)15/h1-4H,5H2,(H2,12,15) |
| InChIKey | HMTLNHGEIQEDBX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|