C13H15F4N3O5 — CID 4536460
2,2,3,3-tetrafluoropropyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate (PubChem CID 4536460) has the molecular formula C13H15F4N3O5 and a molecular weight of 369.27 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4536460 |
| Molecular Formula | C13H15F4N3O5 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
| SMILES | COc1cc(NC(=O)CCC(=O)OCC(F)(F)C(F)F)nc(OC)n1 |
| InChI | InChI=1S/C13H15F4N3O5/c1-23-9-5-7(19-12(20-9)24-2)18-8(21)3-4-10(22)25-6-13(16,17)11(14)15/h5,11H,3-4,6H2,1-2H3,(H,18,19,20,21) |
| InChIKey | SSRWOYREHPYVRE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|