C17H17N3OS — CID 45365632
N-[3-(phenylcarbamothioylamino)phenyl]cyclopropanecarboxamide (PubChem CID 45365632) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is N-[3-(phenylcarbamothioylamino)phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-(phenylcarbamothioylamino)phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 45365632 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-[3-(phenylcarbamothioylamino)phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1cccc(NC(=S)Nc2ccccc2)c1)C1CC1 |
| InChI | InChI=1S/C17H17N3OS/c21-16(12-9-10-12)18-14-7-4-8-15(11-14)20-17(22)19-13-5-2-1-3-6-13/h1-8,11-12H,9-10H2,(H,18,21)(H2,19,20,22) |
| InChIKey | ZNSAALBOTUMEJK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|