C19H26N4OS — CID 45367641
4-[2-[[5-(2-phenylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]morpholine (PubChem CID 45367641) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is 4-[2-[[5-(2-phenylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]morpholine.
| Compound Name | 4-[2-[[5-(2-phenylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]morpholine |
|---|---|
| PubChem CID | 45367641 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-[2-[[5-(2-phenylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]morpholine |
| SMILES | C=CCn1c(CCc2ccccc2)nnc1SCCN1CCOCC1 |
| InChI | InChI=1S/C19H26N4OS/c1-2-10-23-18(9-8-17-6-4-3-5-7-17)20-21-19(23)25-16-13-22-11-14-24-15-12-22/h2-7H,1,8-16H2 |
| InChIKey | VSKSOYMUNOVBDT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|